Nome del prodotto |
7-Phenylheptanoic acid |
Formula molecolare |
C13H18O2 |
Peso Molecolare |
206.2808 |
InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
Numero CAS |
40228-90-8 |
Struttura molecolare |
|
Densità |
1.034g/cm3 |
Punto di ebollizione |
356.5°C at 760 mmHg |
Indice di rifrazione |
1.519 |
Punto d'infiammabilità |
253.5°C |
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|