Ονομασία του προϊόντος |
1-Bromo-4-chloro-2-nitrobenzene |
Συνώνυμα |
2-Bromo-5-chloronitrobenzene |
MF |
C6H3BrClNO2 |
Μοριακό βάρος |
236.4505 |
InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
CAS ΟΧΙ |
41513-04-6 |
EINECS |
255-421-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.827g/cm3 |
Σημείο τήξης |
67-70℃ |
Σημείο βρασμού |
242.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.618 |
Σημείο ανάφλεξης |
100.5°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|