اسم المنتج |
1-Bromo-4-chloro-2-nitrobenzene |
الاسم المستعار |
2-Bromo-5-chloronitrobenzene |
الصيغة الجزيئية |
C6H3BrClNO2 |
الوزن الجزيئي الغرامي |
236.4505 |
InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
إستراتيجية المساعدة القطرية |
41513-04-6 |
المفوضية الأوروبية رقم |
255-421-4 |
بنية جزيئية |
|
كثافة |
1.827g/cm3 |
درجة الإنصهار |
67-70℃ |
نقطة الغليان |
242.5°C at 760 mmHg |
معامل الإنكسار |
1.618 |
نقطة الوميض |
100.5°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|