Название продукта |
1-Bromo-4-chloro-2-nitrobenzene |
Синонимы |
2-Bromo-5-chloronitrobenzene |
Молекулярная формула |
C6H3BrClNO2 |
Молекулярный вес |
236.4505 |
InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
Регистрационный номер CAS |
41513-04-6 |
EINECS |
255-421-4 |
Молекулярная структура |
|
Плотность |
1.827g/cm3 |
Температура плавления |
67-70℃ |
Точка кипения |
242.5°C at 760 mmHg |
Показатель преломления |
1.618 |
Температура вспышки |
100.5°C |
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|