نام محصول |
2-Chloro-6-iodotoluene |
مترادف |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
میدان مغناطیسی |
C7H6ClI |
وزن مولکولی |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
شماره سیایاس |
42048-11-3 |
ساختار مولکولی |
|
تراکم |
1.806g/cm3 |
نقطه غلیان |
243°C at 760 mmHg |
ضریب شکست |
1.616 |
نقطه اشتعال |
100.8°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|