상품명칭 |
2-Chloro-6-iodotoluene |
별명 |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
분자식 |
C7H6ClI |
분자량 |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
cas번호 |
42048-11-3 |
분자 구조 |
|
밀도 |
1.806g/cm3 |
비등점 |
243°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
100.8°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|