Ürün Adı |
2-Chloro-6-iodotoluene |
Eş anlamlı |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
Moleküler Formülü |
C7H6ClI |
Molekül Ağırlığı |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS kayıt numarası |
42048-11-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.806g/cm3 |
Kaynama noktası |
243°C at 760 mmHg |
Kırılma indisi |
1.616 |
Alevlenme noktası |
100.8°C |
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|