product Name |
2,5-Dimethylresorcinol |
Synonyms |
2,5-dimethylbenzene-1,3-diol |
Molecular Formula |
C8H10O2 |
Molecular Weight |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
CAS Registry Number |
488-87-9 |
EINECS |
207-688-3 |
Molecular Structure |
|
Density |
1.162g/cm3 |
Melting point |
161℃ |
Boiling point |
284.1°C at 760 mmHg |
Refractive index |
1.582 |
Flash point |
140.8°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|