उत्पाद का नाम |
2,5-Dimethylresorcinol |
समानार्थी |
2,5-dimethylbenzene-1,3-diol |
आणविक फार्मूला |
C8H10O2 |
आण्विक वजन |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
कैस रजिस्टी संख्या |
488-87-9 |
EINECS |
207-688-3 |
आणविक संरचना |
|
घनत्व |
1.162g/cm3 |
गलनांक |
161℃ |
उबलने का समय |
284.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.582 |
फ्लैश प्वाइंट |
140.8°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|