اسم المنتج |
2,5-Dimethylresorcinol |
الاسم المستعار |
2,5-dimethylbenzene-1,3-diol |
الصيغة الجزيئية |
C8H10O2 |
الوزن الجزيئي الغرامي |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
إستراتيجية المساعدة القطرية |
488-87-9 |
المفوضية الأوروبية رقم |
207-688-3 |
بنية جزيئية |
|
كثافة |
1.162g/cm3 |
درجة الإنصهار |
161℃ |
نقطة الغليان |
284.1°C at 760 mmHg |
معامل الإنكسار |
1.582 |
نقطة الوميض |
140.8°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|