produktnavn |
Hexaketocyclohexane octahydrate |
Synonymer |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
Molekylær Formel |
C6H16O14 |
Molekylvekt |
312.1828 |
InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
CAS-nummer |
527-31-1 |
EINECS |
208-412-4 |
Molecular Structure |
|
Smeltepunkt |
90-93℃ |
Kokepunkt |
344.7°C at 760 mmHg |
Flammepunktet |
152°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|