Ürün Adı |
Hexaketocyclohexane octahydrate |
Eş anlamlı |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
Moleküler Formülü |
C6H16O14 |
Molekül Ağırlığı |
312.1828 |
InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
CAS kayıt numarası |
527-31-1 |
EINECS |
208-412-4 |
Moleküler Yapısı |
|
Ergime noktası |
90-93℃ |
Kaynama noktası |
344.7°C at 760 mmHg |
Alevlenme noktası |
152°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|