Nazwa produktu: |
Hexaketocyclohexane octahydrate |
Synonimy |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
MF |
C6H16O14 |
Masie czÄ…steczkowej |
312.1828 |
InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
Nr CAS |
527-31-1 |
EINECS |
208-412-4 |
Struktury molekularnej |
|
Temperatura topnienia |
90-93℃ |
Temperatura wrzenia |
344.7°C at 760 mmHg |
Temperatura zapłonu |
152°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21:Harmful by inhalation and in contact with skin.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|