product Name |
2,6-Dichlorocinnamic acid |
Synonyms |
Cinnamic acid, 2,6-dichloro- (6CI,7CI); 3-(2,6-Dichlorophenyl)-2-propenoic acid; NSC 1762; 2-Propenoic acid, 3-(2,6-dichlorophenyl)-; 3,4-dihydroisoquinolin-2(1H)-yl(thiophen-2-yl)methanone; (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid; (2E)-3-(2,6-dichlorophenyl)prop-2-enoate |
Molecular Formula |
C9H5Cl2O2 |
Molecular Weight |
216.0413 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
CAS Registry Number |
5345-89-1 |
EINECS |
226-301-9 |
Molecular Structure |
|
Melting point |
192-196℃ |
Boiling point |
355.8°C at 760 mmHg |
Flash point |
169°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R37/38:Irritating to respiratory system and skin.;
|
Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
|
|