Название продукта |
2,6-Dichlorocinnamic acid |
Синонимы |
Cinnamic acid, 2,6-dichloro- (6CI,7CI); 3-(2,6-Dichlorophenyl)-2-propenoic acid; NSC 1762; 2-Propenoic acid, 3-(2,6-dichlorophenyl)-; 3,4-dihydroisoquinolin-2(1H)-yl(thiophen-2-yl)methanone; (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid; (2E)-3-(2,6-dichlorophenyl)prop-2-enoate |
Молекулярная формула |
C9H5Cl2O2 |
Молекулярный вес |
216.0413 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
Регистрационный номер CAS |
5345-89-1 |
EINECS |
226-301-9 |
Молекулярная структура |
|
Температура плавления |
192-196℃ |
Точка кипения |
355.8°C at 760 mmHg |
Температура вспышки |
169°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R37/38:Irritating to respiratory system and skin.;
|
Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
|
|