상품명칭 |
2,6-Dichlorocinnamic acid |
별명 |
Cinnamic acid, 2,6-dichloro- (6CI,7CI); 3-(2,6-Dichlorophenyl)-2-propenoic acid; NSC 1762; 2-Propenoic acid, 3-(2,6-dichlorophenyl)-; 3,4-dihydroisoquinolin-2(1H)-yl(thiophen-2-yl)methanone; (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid; (2E)-3-(2,6-dichlorophenyl)prop-2-enoate |
분자식 |
C9H5Cl2O2 |
분자량 |
216.0413 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
cas번호 |
5345-89-1 |
EC번호 |
226-301-9 |
분자 구조 |
|
녹는 점 |
192-196℃ |
비등점 |
355.8°C at 760 mmHg |
인화점 |
169°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R37/38:Irritating to respiratory system and skin.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
|
|