שם המוצר |
3-Amino-3-(2-nitrophenyl)propionic acid |
נרדפות |
3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate |
מולקולרית פורמולה |
C9H10N2O4 |
משקל מולקולרי |
210.1867 |
InChI |
InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1 |
מספר CAS |
5678-48-8 |
מבנה מולקולרי |
|
צפיפות |
1.404g/cm3 |
נקודת ההתוך |
218℃ |
נקודת רתיחה |
423.8°C at 760 mmHg |
משקל סגולי |
1.612 |
נקודת הבזק |
210.1°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|