3-Amino-3-(2-nitrophenyl)propionic acid

상품명칭	3-Amino-3-(2-nitrophenyl)propionic acid
별명	3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate
분자식	C₉H₁₀N₂O₄
분자량	210.1867
InChI	InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1
cas번호	5678-48-8
분자 구조
밀도	1.404g/cm³
녹는 점	218℃
비등점	423.8°C at 760 mmHg
굴절 지수	1.612
인화점	210.1°C
위험성 표시	Xi:Irritant;
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.;