Nama produk |
3-Amino-3-(2-nitrophenyl)propionic acid |
Sinonim |
3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate |
MF |
C9H10N2O4 |
Berat Molekul |
210.1867 |
InChI |
InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1 |
CAS NO |
5678-48-8 |
Struktur Molekul |
|
Kepadatan |
1.404g/cm3 |
Titik lebur |
218℃ |
Titik didih |
423.8°C at 760 mmHg |
Indeks bias |
1.612 |
Titik nyala |
210.1°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|