product Name |
2-Chloro-6-fluorobenzyl bromide |
Synonyms |
alpha-Bromo-2-chloro-6-fluorotoluene; 2-(bromomethyl)-1-chloro-3-fluorobenzene |
Molecular Formula |
C7H5BrClF |
Molecular Weight |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
CAS Registry Number |
68220-26-8 |
Molecular Structure |
|
Density |
1.654g/cm3 |
Boiling point |
222°C at 760 mmHg |
Refractive index |
1.561 |
Flash point |
88.1°C |
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|