اسم المنتج |
2-Chloro-6-fluorobenzyl bromide |
الاسم المستعار |
alpha-Bromo-2-chloro-6-fluorotoluene; 2-(bromomethyl)-1-chloro-3-fluorobenzene |
الصيغة الجزيئية |
C7H5BrClF |
الوزن الجزيئي الغرامي |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
إستراتيجية المساعدة القطرية |
68220-26-8 |
بنية جزيئية |
|
كثافة |
1.654g/cm3 |
نقطة الغليان |
222°C at 760 mmHg |
معامل الإنكسار |
1.561 |
نقطة الوميض |
88.1°C |
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|