Ονομασία του προϊόντος |
2-Chloro-6-fluorobenzyl bromide |
Συνώνυμα |
alpha-Bromo-2-chloro-6-fluorotoluene; 2-(bromomethyl)-1-chloro-3-fluorobenzene |
MF |
C7H5BrClF |
Μοριακό βάρος |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
CAS ΟΧΙ |
68220-26-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.654g/cm3 |
Σημείο βρασμού |
222°C at 760 mmHg |
Δείκτης διάθλασης |
1.561 |
Σημείο ανάφλεξης |
88.1°C |
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|