Ονομασία του προϊόντος |
3-Chloro-N,N-dimethylaniline |
Συνώνυμα |
3-Chloro-NN-dimethylaniline |
MF |
C8H10ClN |
Μοριακό βάρος |
155.6247 |
InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS ΟΧΙ |
6848-13-1 |
EINECS |
229-935-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.117g/cm3 |
Σημείο βρασμού |
232.663°C at 760 mmHg |
Δείκτης διάθλασης |
1.566 |
Σημείο ανάφλεξης |
94.512°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|