Naam product |
3-Chloro-N,N-dimethylaniline |
Synoniemen |
3-Chloro-NN-dimethylaniline |
MF |
C8H10ClN |
Molecuulgewicht |
155.6247 |
InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS-nummer |
6848-13-1 |
EINECS |
229-935-4 |
Moleculaire Structuur |
|
Dichtheid |
1.117g/cm3 |
Kookpunt |
232.663°C at 760 mmHg |
Brekingsindex |
1.566 |
Vlampunt |
94.512°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|