שם המוצר |
3-Chloro-N,N-dimethylaniline |
נרדפות |
3-Chloro-NN-dimethylaniline |
מולקולרית פורמולה |
C8H10ClN |
משקל מולקולרי |
155.6247 |
InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
מספר CAS |
6848-13-1 |
EINECS |
229-935-4 |
מבנה מולקולרי |
|
צפיפות |
1.117g/cm3 |
נקודת רתיחה |
232.663°C at 760 mmHg |
משקל סגולי |
1.566 |
נקודת הבזק |
94.512°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|