product Name |
1-(4-Methylphenyl)-1-cyclopentanecarbonitrile |
Synonyms |
1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
Molecular Formula |
C13H15N |
Molecular Weight |
185.2649 |
InChI |
InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS Registry Number |
68983-70-0 |
EINECS |
273-487-2 |
Molecular Structure |
|
Density |
1.02g/cm3 |
Boiling point |
326.2°C at 760 mmHg |
Refractive index |
1.546 |
Flash point |
121.3°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|