produktnavn |
1-(4-Methylphenyl)-1-cyclopentanecarbonitrile |
Synonymer |
1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
Molekylær Formel |
C13H15N |
Molekylvekt |
185.2649 |
InChI |
InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS-nummer |
68983-70-0 |
EINECS |
273-487-2 |
Molecular Structure |
|
Tetthet |
1.02g/cm3 |
Kokepunkt |
326.2°C at 760 mmHg |
Brytningsindeks |
1.546 |
Flammepunktet |
121.3°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|