상품명칭 |
1-(4-Methylphenyl)-1-cyclopentanecarbonitrile |
별명 |
1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
분자식 |
C13H15N |
분자량 |
185.2649 |
InChI |
InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
cas번호 |
68983-70-0 |
EC번호 |
273-487-2 |
분자 구조 |
|
밀도 |
1.02g/cm3 |
비등점 |
326.2°C at 760 mmHg |
굴절 지수 |
1.546 |
인화점 |
121.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|