Produkt-Name |
Homophthalic anhydride |
Synonyme |
1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
Molekulare Formel |
C9H6O3 |
Molecular Weight |
162.1421 |
InChI |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
CAS Registry Number |
703-59-3 |
EINECS |
211-873-4 |
Molecular Structure |
|
Dichte |
1.347g/cm3 |
Schmelzpunkt |
140-144℃ |
Siedepunkt |
324.5°C at 760 mmHg |
Brechungsindex |
1.584 |
Flammpunkt |
159°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|