상품명칭 |
Homophthalic anhydride |
별명 |
1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
분자식 |
C9H6O3 |
분자량 |
162.1421 |
InChI |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
cas번호 |
703-59-3 |
EC번호 |
211-873-4 |
분자 구조 |
|
밀도 |
1.347g/cm3 |
녹는 점 |
140-144℃ |
비등점 |
324.5°C at 760 mmHg |
굴절 지수 |
1.584 |
인화점 |
159°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|