Nama produk |
Homophthalic anhydride |
Sinonim |
1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
MF |
C9H6O3 |
Berat Molekul |
162.1421 |
InChI |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
CAS NO |
703-59-3 |
EINECS |
211-873-4 |
Struktur Molekul |
|
Kepadatan |
1.347g/cm3 |
Titik lebur |
140-144℃ |
Titik didih |
324.5°C at 760 mmHg |
Indeks bias |
1.584 |
Titik nyala |
159°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|