Nome del prodotto |
9-chloroanthracene |
Sinonimi |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
Formula molecolare |
C14H9Cl |
Peso Molecolare |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
Numero CAS |
716-53-0 |
EINECS |
211-937-1 |
Struttura molecolare |
|
Densità |
1.253g/cm3 |
Punto di fusione |
103-103℃ |
Punto di ebollizione |
370.1°C at 760 mmHg |
Indice di rifrazione |
1.717 |
Punto d'infiammabilità |
179.2°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|