Nazwa produktu: |
9-chloroanthracene |
Synonimy |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
MF |
C14H9Cl |
Masie cząsteczkowej |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
Nr CAS |
716-53-0 |
EINECS |
211-937-1 |
Struktury molekularnej |
|
Gęstość |
1.253g/cm3 |
Temperatura topnienia |
103-103℃ |
Temperatura wrzenia |
370.1°C at 760 mmHg |
Współczynnik załamania |
1.717 |
Temperatura zapłonu |
179.2°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|