상품명칭 |
9-chloroanthracene |
별명 |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
분자식 |
C14H9Cl |
분자량 |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
cas번호 |
716-53-0 |
EC번호 |
211-937-1 |
분자 구조 |
|
밀도 |
1.253g/cm3 |
녹는 점 |
103-103℃ |
비등점 |
370.1°C at 760 mmHg |
굴절 지수 |
1.717 |
인화점 |
179.2°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|