Nama produk |
iodopentafluorobenzene |
Sinonim |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
MF |
C6F5I |
Berat Molekul |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
CAS NO |
827-15-6 |
EINECS |
212-565-2 |
Struktur Molekul |
|
Kepadatan |
2.217g/cm3 |
Titik didih |
166.7°C at 760 mmHg |
Indeks bias |
1.502 |
Titik nyala |
61.3°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|