نام محصول |
iodopentafluorobenzene |
مترادف |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
میدان مغناطیسی |
C6F5I |
وزن مولکولی |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
شماره سیایاس |
827-15-6 |
تعداد کمیسیون اروپایی |
212-565-2 |
ساختار مولکولی |
|
تراکم |
2.217g/cm3 |
نقطه غلیان |
166.7°C at 760 mmHg |
ضریب شکست |
1.502 |
نقطه اشتعال |
61.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|