اسم المنتج |
iodopentafluorobenzene |
الاسم المستعار |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
الصيغة الجزيئية |
C6F5I |
الوزن الجزيئي الغرامي |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
إستراتيجية المساعدة القطرية |
827-15-6 |
المفوضية الأوروبية رقم |
212-565-2 |
بنية جزيئية |
|
كثافة |
2.217g/cm3 |
نقطة الغليان |
166.7°C at 760 mmHg |
معامل الإنكسار |
1.502 |
نقطة الوميض |
61.3°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|