3,5-Dihydroxy-2-naphthalenecarboxylic acid

نام محصول	3,5-Dihydroxy-2-naphthalenecarboxylic acid
مترادف	3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate
میدان مغناطیسی	C₁₁H₇O₄
وزن مولکولی	203.1714
InChI	InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1
شماره سیایاس	89-35-0
تعداد کمیسیون اروپایی	201-900-8
ساختار مولکولی
نقطه ذوب	275-280℃
نقطه غلیان	442.2°C at 760 mmHg
نقطه اشتعال	235.3°C
کدهای خطر	R36/37/38:Irritating to eyes, respiratory system and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;