نام محصول |
3,5-Dihydroxy-2-naphthalenecarboxylic acid |
مترادف |
3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
میدان مغناطیسی |
C11H7O4 |
وزن مولکولی |
203.1714 |
InChI |
InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
شماره سیایاس |
89-35-0 |
تعداد کمیسیون اروپایی |
201-900-8 |
ساختار مولکولی |
|
نقطه ذوب |
275-280℃ |
نقطه غلیان |
442.2°C at 760 mmHg |
نقطه اشتعال |
235.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|