상품명칭 |
3,5-Dihydroxy-2-naphthalenecarboxylic acid |
별명 |
3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
분자식 |
C11H7O4 |
분자량 |
203.1714 |
InChI |
InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
cas번호 |
89-35-0 |
EC번호 |
201-900-8 |
분자 구조 |
|
녹는 점 |
275-280℃ |
비등점 |
442.2°C at 760 mmHg |
인화점 |
235.3°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|