Nazwa produktu: |
3,5-Dihydroxy-2-naphthalenecarboxylic acid |
Synonimy |
3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
MF |
C11H7O4 |
Masie cząsteczkowej |
203.1714 |
InChI |
InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
Nr CAS |
89-35-0 |
EINECS |
201-900-8 |
Struktury molekularnej |
|
Temperatura topnienia |
275-280℃ |
Temperatura wrzenia |
442.2°C at 760 mmHg |
Temperatura zapłonu |
235.3°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|