5-Methyl-1-phenylpyrazole-4-carboxylic acid

termék neve	5-Methyl-1-phenylpyrazole-4-carboxylic acid
Szinonimák	5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid
MF	C₁₁H₁₀N₂O₂
Molekulatömeg	202.2093
InChI	InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15)
CAS-szám	91138-00-0
Molekuláris szerkezete
Sűrűség	1.24g/cm³
Olvadáspont	163℃
Forráspont	382.9°C at 760 mmHg
Törésmutató	1.617
Gyulladáspont	185.4°C
Veszély szimbólumok	Xi:Irritant;
Kockázatot kódok	R36/37/38:Irritating to eyes, respiratory system and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;