نام محصول |
5-Methyl-1-phenylpyrazole-4-carboxylic acid |
مترادف |
5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
میدان مغناطیسی |
C11H10N2O2 |
وزن مولکولی |
202.2093 |
InChI |
InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
شماره سیایاس |
91138-00-0 |
ساختار مولکولی |
|
تراکم |
1.24g/cm3 |
نقطه ذوب |
163℃ |
نقطه غلیان |
382.9°C at 760 mmHg |
ضریب شکست |
1.617 |
نقطه اشتعال |
185.4°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|