상품명칭 |
5-Methyl-1-phenylpyrazole-4-carboxylic acid |
별명 |
5-Methyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
분자식 |
C11H10N2O2 |
분자량 |
202.2093 |
InChI |
InChI=1/C11H10N2O2/c1-8-10(11(14)15)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15) |
cas번호 |
91138-00-0 |
분자 구조 |
|
밀도 |
1.24g/cm3 |
녹는 점 |
163℃ |
비등점 |
382.9°C at 760 mmHg |
굴절 지수 |
1.617 |
인화점 |
185.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|