Benzene, 1,2-dimethoxy-4-(1-propenyl)-

שם המוצר	Benzene, 1,2-dimethoxy-4-(1-propenyl)-
נרדפות	1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene
מולקולרית פורמולה	C₁₁H₁₄O₂
משקל מולקולרי	178.2277
InChI	InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4-
מספר CAS	93-16-3
EINECS	202-224-6
מבנה מולקולרי
צפיפות	0.998g/cm³
נקודת ההתוך	62.6℃
נקודת רתיחה	271.1°C at 760 mmHg
משקל סגולי	1.534
נקודת הבזק	104.5°C
סיכונים קודי	R36/38:Irritating to eyes and skin.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;