اسم المنتج |
Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
الاسم المستعار |
1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
الصيغة الجزيئية |
C11H14O2 |
الوزن الجزيئي الغرامي |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
إستراتيجية المساعدة القطرية |
93-16-3 |
المفوضية الأوروبية رقم |
202-224-6 |
بنية جزيئية |
|
كثافة |
0.998g/cm3 |
درجة الإنصهار |
62.6℃ |
نقطة الغليان |
271.1°C at 760 mmHg |
معامل الإنكسار |
1.534 |
نقطة الوميض |
104.5°C |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|