Benzene, 1,2-dimethoxy-4-(1-propenyl)-

उत्पाद का नाम	Benzene, 1,2-dimethoxy-4-(1-propenyl)-
समानार्थी	1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene
आणविक फार्मूला	C₁₁H₁₄O₂
आण्विक वजन	178.2277
InChI	InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4-
कैस रजिस्टी संख्या	93-16-3
EINECS	202-224-6
आणविक संरचना
घनत्व	0.998g/cm³
गलनांक	62.6℃
उबलने का समय	271.1°C at 760 mmHg
अपवर्तक सूचकांक	1.534
फ्लैश प्वाइंट	104.5°C
खतरे के कोड	R36/38:Irritating to eyes and skin.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;