product Name |
3-Methoxycatechol |
Synonyms |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
Molecular Formula |
C7H8O3 |
Molecular Weight |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
CAS Registry Number |
934-00-9 |
EINECS |
213-276-4 |
Molecular Structure |
|
Density |
1.27g/cm3 |
Melting point |
39-43℃ |
Boiling point |
268.1°C at 760 mmHg |
Refractive index |
1.579 |
Flash point |
119.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|