Naam product |
3-Methoxycatechol |
Synoniemen |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
MF |
C7H8O3 |
Molecuulgewicht |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
CAS-nummer |
934-00-9 |
EINECS |
213-276-4 |
Moleculaire Structuur |
|
Dichtheid |
1.27g/cm3 |
Smeltpunt |
39-43℃ |
Kookpunt |
268.1°C at 760 mmHg |
Brekingsindex |
1.579 |
Vlampunt |
119.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|