उत्पाद का नाम |
3-Methoxycatechol |
समानार्थी |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
आणविक फार्मूला |
C7H8O3 |
आण्विक वजन |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
कैस रजिस्टी संख्या |
934-00-9 |
EINECS |
213-276-4 |
आणविक संरचना |
|
घनत्व |
1.27g/cm3 |
गलनांक |
39-43℃ |
उबलने का समय |
268.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.579 |
फ्लैश प्वाइंट |
119.5°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|