نام محصول |
DL-2-(4-chlorophenyl)propan-oic acid |
مترادف |
4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
میدان مغناطیسی |
C9H9ClO2 |
وزن مولکولی |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
شماره سیایاس |
938-95-4 |
تعداد کمیسیون اروپایی |
213-351-1 |
ساختار مولکولی |
|
تراکم |
1.277g/cm3 |
نقطه غلیان |
332.2°C at 760 mmHg |
ضریب شکست |
1.565 |
نقطه اشتعال |
154.7°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|